About CID 25199846
CID 25199846 (PubChem CID 25199846) has the molecular formula C12H30Sn2
and a molecular weight of 411.79 g/mol.
Molecular Properties
| Compound Name | CID 25199846 |
| PubChem CID | 25199846 |
| Molecular Formula | C12H30Sn2 |
| Molecular Weight | 411.79 g/mol |
| Exact Mass | 414.04 |
| IUPAC Name | — |
| SMILES | CC[Sn](CC)CC.CC[Sn](CC)CC |
| InChI | InChI=1S/6C2H5.2Sn/c6*1-2;;/h6*1H2,2H3;; |
| InChIKey | LOAWHQCNQSFKDK-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 411.79 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 25199846 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 25199846?
The IUPAC name of CID 25199846 (CID 25199846) is not available.
What is the SMILES notation for CID 25199846?
The canonical SMILES for CID 25199846 is CC[Sn](CC)CC.CC[Sn](CC)CC.
What is the InChIKey of CID 25199846?
The InChIKey is LOAWHQCNQSFKDK-UHFFFAOYSA-N. The full InChI is InChI=1S/6C2H5.2Sn/c6*1-2;;/h6*1H2,2H3;;.
What are the key properties of CID 25199846?
CID 25199846 has a molecular weight of 411.79 g/mol, XLogP of 5.08, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 25199846 is sourced from PubChem (CID 25199846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).