About cyclopenta-1,3-diene;2-ethenylcyclopenta-1,3-diene;iron
cyclopenta-1,3-diene;2-ethenylcyclopenta-1,3-diene;iron (PubChem CID 25200006) has the molecular formula C12H12Fe-2
and a molecular weight of 212.07 g/mol. Its IUPAC name is cyclopenta-1,3-diene;2-ethenylcyclopenta-1,3-diene;iron.
Molecular Properties
| Compound Name | cyclopenta-1,3-diene;2-ethenylcyclopenta-1,3-diene;iron |
| PubChem CID | 25200006 |
| Molecular Formula | C12H12Fe-2 |
| Molecular Weight | 212.07 g/mol |
| Exact Mass | 212.03 |
| IUPAC Name | cyclopenta-1,3-diene;2-ethenylcyclopenta-1,3-diene;iron |
| SMILES | C=Cc1cc[cH-]c1.[Fe].c1cc[cH-]c1 |
| InChI | InChI=1S/C7H7.C5H5.Fe/c1-2-7-5-3-4-6-7;1-2-4-5-3-1;/h2-6H,1H2;1-5H;/q2*-1; |
| InChIKey | AIZWEJPSXAQQRF-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.07 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze cyclopenta-1,3-diene;2-ethenylcyclopenta-1,3-diene;iron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopenta-1,3-diene;2-ethenylcyclopenta-1,3-diene;iron?
The IUPAC name of cyclopenta-1,3-diene;2-ethenylcyclopenta-1,3-diene;iron (CID 25200006) is cyclopenta-1,3-diene;2-ethenylcyclopenta-1,3-diene;iron.
What is the SMILES notation for cyclopenta-1,3-diene;2-ethenylcyclopenta-1,3-diene;iron?
The canonical SMILES for cyclopenta-1,3-diene;2-ethenylcyclopenta-1,3-diene;iron is C=Cc1cc[cH-]c1.[Fe].c1cc[cH-]c1.
What is the InChIKey of cyclopenta-1,3-diene;2-ethenylcyclopenta-1,3-diene;iron?
The InChIKey is AIZWEJPSXAQQRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7.C5H5.Fe/c1-2-7-5-3-4-6-7;1-2-4-5-3-1;/h2-6H,1H2;1-5H;/q2*-1;.
What are the key properties of cyclopenta-1,3-diene;2-ethenylcyclopenta-1,3-diene;iron?
cyclopenta-1,3-diene;2-ethenylcyclopenta-1,3-diene;iron has a molecular weight of 212.07 g/mol, XLogP of 3.45, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopenta-1,3-diene;2-ethenylcyclopenta-1,3-diene;iron is sourced from PubChem (CID 25200006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).