About 2-(2-oxo-1,3-dihydroindol-3-yl)acetate
2-(2-oxo-1,3-dihydroindol-3-yl)acetate (PubChem CID 25200337) has the molecular formula C10H8NO3-
and a molecular weight of 190.18 g/mol. Its IUPAC name is 2-(2-oxo-1,3-dihydroindol-3-yl)acetate.
Molecular Properties
| Compound Name | 2-(2-oxo-1,3-dihydroindol-3-yl)acetate |
| PubChem CID | 25200337 |
| Molecular Formula | C10H8NO3- |
| Molecular Weight | 190.18 g/mol |
| Exact Mass | 190.05 |
| IUPAC Name | 2-(2-oxo-1,3-dihydroindol-3-yl)acetate |
| SMILES | O=C([O-])CC1C(=O)Nc2ccccc21 |
| InChI | InChI=1S/C10H9NO3/c12-9(13)5-7-6-3-1-2-4-8(6)11-10(7)14/h1-4,7H,5H2,(H,11,14)(H,12,13)/p-1 |
| InChIKey | ILGMGHZPXRDCCS-UHFFFAOYSA-M |
| XLogP | -0.14 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.18 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(2-oxo-1,3-dihydroindol-3-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-oxo-1,3-dihydroindol-3-yl)acetate?
The IUPAC name of 2-(2-oxo-1,3-dihydroindol-3-yl)acetate (CID 25200337) is 2-(2-oxo-1,3-dihydroindol-3-yl)acetate.
What is the SMILES notation for 2-(2-oxo-1,3-dihydroindol-3-yl)acetate?
The canonical SMILES for 2-(2-oxo-1,3-dihydroindol-3-yl)acetate is O=C([O-])CC1C(=O)Nc2ccccc21.
What is the InChIKey of 2-(2-oxo-1,3-dihydroindol-3-yl)acetate?
The InChIKey is ILGMGHZPXRDCCS-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H9NO3/c12-9(13)5-7-6-3-1-2-4-8(6)11-10(7)14/h1-4,7H,5H2,(H,11,14)(H,12,13)/p-1.
What are the key properties of 2-(2-oxo-1,3-dihydroindol-3-yl)acetate?
2-(2-oxo-1,3-dihydroindol-3-yl)acetate has a molecular weight of 190.18 g/mol, XLogP of -0.14, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-oxo-1,3-dihydroindol-3-yl)acetate is sourced from PubChem (CID 25200337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).