About 2-azaniumyloctanoate
2-azaniumyloctanoate (PubChem CID 25200752) has the molecular formula C8H17NO2
and a molecular weight of 159.23 g/mol. Its IUPAC name is 2-azaniumyloctanoate.
Molecular Properties
| Compound Name | 2-azaniumyloctanoate |
| PubChem CID | 25200752 |
| Molecular Formula | C8H17NO2 |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.13 |
| IUPAC Name | 2-azaniumyloctanoate |
| SMILES | CCCCCCC([NH3+])C(=O)[O-] |
| InChI | InChI=1S/C8H17NO2/c1-2-3-4-5-6-7(9)8(10)11/h7H,2-6,9H2,1H3,(H,10,11) |
| InChIKey | AKVBCGQVQXPRLD-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-azaniumyloctanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-azaniumyloctanoate?
The IUPAC name of 2-azaniumyloctanoate (CID 25200752) is 2-azaniumyloctanoate.
What is the SMILES notation for 2-azaniumyloctanoate?
The canonical SMILES for 2-azaniumyloctanoate is CCCCCCC([NH3+])C(=O)[O-].
What is the InChIKey of 2-azaniumyloctanoate?
The InChIKey is AKVBCGQVQXPRLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO2/c1-2-3-4-5-6-7(9)8(10)11/h7H,2-6,9H2,1H3,(H,10,11).
What are the key properties of 2-azaniumyloctanoate?
2-azaniumyloctanoate has a molecular weight of 159.23 g/mol, XLogP of -0.68, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-azaniumyloctanoate is sourced from PubChem (CID 25200752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).