C8H9NO2 — CID 25200922
(2R,3R)-2,3-dihydro-1H-indole-2,3-diol (PubChem CID 25200922) has the molecular formula C8H9NO2 and a molecular weight of 151.16 g/mol. Its IUPAC name is (2R,3R)-2,3-dihydro-1H-indole-2,3-diol.
| Compound Name | (2R,3R)-2,3-dihydro-1H-indole-2,3-diol |
|---|---|
| PubChem CID | 25200922 |
| Molecular Formula | C8H9NO2 |
| Molecular Weight | 151.16 g/mol |
| Exact Mass | 151.06 |
| IUPAC Name | (2R,3R)-2,3-dihydro-1H-indole-2,3-diol |
| SMILES | O[C@@H]1c2ccccc2N[C@@H]1O |
| InChI | InChI=1S/C8H9NO2/c10-7-5-3-1-2-4-6(5)9-8(7)11/h1-4,7-11H/t7-,8-/m1/s1 |
| InChIKey | MLCFNGQWWKZFBD-HTQZYQBOSA-N |
| XLogP | 0.46 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.16 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |