About 8-hydroxy-2,6-dimethylocta-2,6-dienal
8-hydroxy-2,6-dimethylocta-2,6-dienal (PubChem CID 25201269) has the molecular formula C10H16O2
and a molecular weight of 168.24 g/mol. Its IUPAC name is 8-hydroxy-2,6-dimethylocta-2,6-dienal.
Molecular Properties
| Compound Name | 8-hydroxy-2,6-dimethylocta-2,6-dienal |
| PubChem CID | 25201269 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | 8-hydroxy-2,6-dimethylocta-2,6-dienal |
| SMILES | CC(C=O)=CCCC(C)=CCO |
| InChI | InChI=1S/C10H16O2/c1-9(6-7-11)4-3-5-10(2)8-12/h5-6,8,11H,3-4,7H2,1-2H3 |
| InChIKey | FRKZCCBKUZTFCA-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 8-hydroxy-2,6-dimethylocta-2,6-dienal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-hydroxy-2,6-dimethylocta-2,6-dienal?
The IUPAC name of 8-hydroxy-2,6-dimethylocta-2,6-dienal (CID 25201269) is 8-hydroxy-2,6-dimethylocta-2,6-dienal.
What is the SMILES notation for 8-hydroxy-2,6-dimethylocta-2,6-dienal?
The canonical SMILES for 8-hydroxy-2,6-dimethylocta-2,6-dienal is CC(C=O)=CCCC(C)=CCO.
What is the InChIKey of 8-hydroxy-2,6-dimethylocta-2,6-dienal?
The InChIKey is FRKZCCBKUZTFCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O2/c1-9(6-7-11)4-3-5-10(2)8-12/h5-6,8,11H,3-4,7H2,1-2H3.
What are the key properties of 8-hydroxy-2,6-dimethylocta-2,6-dienal?
8-hydroxy-2,6-dimethylocta-2,6-dienal has a molecular weight of 168.24 g/mol, XLogP of 1.85, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-hydroxy-2,6-dimethylocta-2,6-dienal is sourced from PubChem (CID 25201269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).