About 6-acetyl-5-hydroxy-4-methyl-3-oxocyclohexa-1,5-dien-1-olate
6-acetyl-5-hydroxy-4-methyl-3-oxocyclohexa-1,5-dien-1-olate (PubChem CID 25201494) has the molecular formula C9H9O4-
and a molecular weight of 181.17 g/mol. Its IUPAC name is 6-acetyl-5-hydroxy-4-methyl-3-oxocyclohexa-1,5-dien-1-olate.
Molecular Properties
| Compound Name | 6-acetyl-5-hydroxy-4-methyl-3-oxocyclohexa-1,5-dien-1-olate |
| PubChem CID | 25201494 |
| Molecular Formula | C9H9O4- |
| Molecular Weight | 181.17 g/mol |
| Exact Mass | 181.05 |
| IUPAC Name | 6-acetyl-5-hydroxy-4-methyl-3-oxocyclohexa-1,5-dien-1-olate |
| SMILES | CC(=O)C1=C(O)C(C)C(=O)C=C1[O-] |
| InChI | InChI=1S/C9H10O4/c1-4-6(11)3-7(12)8(5(2)10)9(4)13/h3-4,12-13H,1-2H3/p-1 |
| InChIKey | SQDIEOIQBURNFA-UHFFFAOYSA-M |
| XLogP | -0.15 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.17 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-acetyl-5-hydroxy-4-methyl-3-oxocyclohexa-1,5-dien-1-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-acetyl-5-hydroxy-4-methyl-3-oxocyclohexa-1,5-dien-1-olate?
The IUPAC name of 6-acetyl-5-hydroxy-4-methyl-3-oxocyclohexa-1,5-dien-1-olate (CID 25201494) is 6-acetyl-5-hydroxy-4-methyl-3-oxocyclohexa-1,5-dien-1-olate.
What is the SMILES notation for 6-acetyl-5-hydroxy-4-methyl-3-oxocyclohexa-1,5-dien-1-olate?
The canonical SMILES for 6-acetyl-5-hydroxy-4-methyl-3-oxocyclohexa-1,5-dien-1-olate is CC(=O)C1=C(O)C(C)C(=O)C=C1[O-].
What is the InChIKey of 6-acetyl-5-hydroxy-4-methyl-3-oxocyclohexa-1,5-dien-1-olate?
The InChIKey is SQDIEOIQBURNFA-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H10O4/c1-4-6(11)3-7(12)8(5(2)10)9(4)13/h3-4,12-13H,1-2H3/p-1.
What are the key properties of 6-acetyl-5-hydroxy-4-methyl-3-oxocyclohexa-1,5-dien-1-olate?
6-acetyl-5-hydroxy-4-methyl-3-oxocyclohexa-1,5-dien-1-olate has a molecular weight of 181.17 g/mol, XLogP of -0.15, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-acetyl-5-hydroxy-4-methyl-3-oxocyclohexa-1,5-dien-1-olate is sourced from PubChem (CID 25201494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).