About 4-acetyl-3,5-dihydroxy-6-methylcyclohexa-2,4-dien-1-one
4-acetyl-3,5-dihydroxy-6-methylcyclohexa-2,4-dien-1-one (PubChem CID 25201495) has the molecular formula C9H10O4
and a molecular weight of 182.17 g/mol. Its IUPAC name is 4-acetyl-3,5-dihydroxy-6-methylcyclohexa-2,4-dien-1-one.
Molecular Properties
| Compound Name | 4-acetyl-3,5-dihydroxy-6-methylcyclohexa-2,4-dien-1-one |
| PubChem CID | 25201495 |
| Molecular Formula | C9H10O4 |
| Molecular Weight | 182.17 g/mol |
| Exact Mass | 182.06 |
| IUPAC Name | 4-acetyl-3,5-dihydroxy-6-methylcyclohexa-2,4-dien-1-one |
| SMILES | CC(=O)C1=C(O)C(C)C(=O)C=C1O |
| InChI | InChI=1S/C9H10O4/c1-4-6(11)3-7(12)8(5(2)10)9(4)13/h3-4,12-13H,1-2H3 |
| InChIKey | SQDIEOIQBURNFA-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.17 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-acetyl-3,5-dihydroxy-6-methylcyclohexa-2,4-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-acetyl-3,5-dihydroxy-6-methylcyclohexa-2,4-dien-1-one?
The IUPAC name of 4-acetyl-3,5-dihydroxy-6-methylcyclohexa-2,4-dien-1-one (CID 25201495) is 4-acetyl-3,5-dihydroxy-6-methylcyclohexa-2,4-dien-1-one.
What is the SMILES notation for 4-acetyl-3,5-dihydroxy-6-methylcyclohexa-2,4-dien-1-one?
The canonical SMILES for 4-acetyl-3,5-dihydroxy-6-methylcyclohexa-2,4-dien-1-one is CC(=O)C1=C(O)C(C)C(=O)C=C1O.
What is the InChIKey of 4-acetyl-3,5-dihydroxy-6-methylcyclohexa-2,4-dien-1-one?
The InChIKey is SQDIEOIQBURNFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O4/c1-4-6(11)3-7(12)8(5(2)10)9(4)13/h3-4,12-13H,1-2H3.
What are the key properties of 4-acetyl-3,5-dihydroxy-6-methylcyclohexa-2,4-dien-1-one?
4-acetyl-3,5-dihydroxy-6-methylcyclohexa-2,4-dien-1-one has a molecular weight of 182.17 g/mol, XLogP of 1.05, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-acetyl-3,5-dihydroxy-6-methylcyclohexa-2,4-dien-1-one is sourced from PubChem (CID 25201495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).