About 5-hydroxy-2-(2-oxidoethenyl)-4,5-dioxopent-2-enoate
5-hydroxy-2-(2-oxidoethenyl)-4,5-dioxopent-2-enoate (PubChem CID 25201912) has the molecular formula C7H4O6-2
and a molecular weight of 184.10 g/mol. Its IUPAC name is 5-hydroxy-2-(2-oxidoethenyl)-4,5-dioxopent-2-enoate.
Molecular Properties
| Compound Name | 5-hydroxy-2-(2-oxidoethenyl)-4,5-dioxopent-2-enoate |
| PubChem CID | 25201912 |
| Molecular Formula | C7H4O6-2 |
| Molecular Weight | 184.10 g/mol |
| Exact Mass | 184.00 |
| IUPAC Name | 5-hydroxy-2-(2-oxidoethenyl)-4,5-dioxopent-2-enoate |
| SMILES | O=C([O-])C(C=C[O-])=CC(=O)C(=O)O |
| InChI | InChI=1S/C7H6O6/c8-2-1-4(6(10)11)3-5(9)7(12)13/h1-3,8H,(H,10,11)(H,12,13)/p-2 |
| InChIKey | QZWBTDVXBPUISR-UHFFFAOYSA-L |
| XLogP | -2.81 |
| TPSA | 117.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.10 |
| LogP ≤ 5 | -2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 5-hydroxy-2-(2-oxidoethenyl)-4,5-dioxopent-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hydroxy-2-(2-oxidoethenyl)-4,5-dioxopent-2-enoate?
The IUPAC name of 5-hydroxy-2-(2-oxidoethenyl)-4,5-dioxopent-2-enoate (CID 25201912) is 5-hydroxy-2-(2-oxidoethenyl)-4,5-dioxopent-2-enoate.
What is the SMILES notation for 5-hydroxy-2-(2-oxidoethenyl)-4,5-dioxopent-2-enoate?
The canonical SMILES for 5-hydroxy-2-(2-oxidoethenyl)-4,5-dioxopent-2-enoate is O=C([O-])C(C=C[O-])=CC(=O)C(=O)O.
What is the InChIKey of 5-hydroxy-2-(2-oxidoethenyl)-4,5-dioxopent-2-enoate?
The InChIKey is QZWBTDVXBPUISR-UHFFFAOYSA-L. The full InChI is InChI=1S/C7H6O6/c8-2-1-4(6(10)11)3-5(9)7(12)13/h1-3,8H,(H,10,11)(H,12,13)/p-2.
What are the key properties of 5-hydroxy-2-(2-oxidoethenyl)-4,5-dioxopent-2-enoate?
5-hydroxy-2-(2-oxidoethenyl)-4,5-dioxopent-2-enoate has a molecular weight of 184.10 g/mol, XLogP of -2.81, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxy-2-(2-oxidoethenyl)-4,5-dioxopent-2-enoate is sourced from PubChem (CID 25201912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).