About 5-oxooctylazanium
5-oxooctylazanium (PubChem CID 25202393) has the molecular formula C8H18NO+
and a molecular weight of 144.24 g/mol. Its IUPAC name is 5-oxooctylazanium.
Molecular Properties
| Compound Name | 5-oxooctylazanium |
| PubChem CID | 25202393 |
| Molecular Formula | C8H18NO+ |
| Molecular Weight | 144.24 g/mol |
| Exact Mass | 144.14 |
| IUPAC Name | 5-oxooctylazanium |
| SMILES | CCCC(=O)CCCC[NH3+] |
| InChI | InChI=1S/C8H17NO/c1-2-5-8(10)6-3-4-7-9/h2-7,9H2,1H3/p+1 |
| InChIKey | UYCHPUIDXXFEKR-UHFFFAOYSA-O |
| XLogP | 0.77 |
| TPSA | 44.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.24 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-oxooctylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-oxooctylazanium?
The IUPAC name of 5-oxooctylazanium (CID 25202393) is 5-oxooctylazanium.
What is the SMILES notation for 5-oxooctylazanium?
The canonical SMILES for 5-oxooctylazanium is CCCC(=O)CCCC[NH3+].
What is the InChIKey of 5-oxooctylazanium?
The InChIKey is UYCHPUIDXXFEKR-UHFFFAOYSA-O. The full InChI is InChI=1S/C8H17NO/c1-2-5-8(10)6-3-4-7-9/h2-7,9H2,1H3/p+1.
What are the key properties of 5-oxooctylazanium?
5-oxooctylazanium has a molecular weight of 144.24 g/mol, XLogP of 0.77, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-oxooctylazanium is sourced from PubChem (CID 25202393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).