C7H16N3O5+ — CID 25202575
diaminomethylidene-[(2S,3R,5S,6R)-2,3,4,5,6-pentahydroxycyclohexyl]azanium (PubChem CID 25202575) has the molecular formula C7H16N3O5+ and a molecular weight of 222.22 g/mol. Its IUPAC name is diaminomethylidene-[(2S,3R,5S,6R)-2,3,4,5,6-pentahydroxycyclohexyl]azanium.
| Compound Name | diaminomethylidene-[(2S,3R,5S,6R)-2,3,4,5,6-pentahydroxycyclohexyl]azanium |
|---|---|
| PubChem CID | 25202575 |
| Molecular Formula | C7H16N3O5+ |
| Molecular Weight | 222.22 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | diaminomethylidene-[(2S,3R,5S,6R)-2,3,4,5,6-pentahydroxycyclohexyl]azanium |
| SMILES | NC(N)=[NH+]C1[C@@H](O)[C@H](O)C(O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C7H15N3O5/c8-7(9)10-1-2(11)4(13)6(15)5(14)3(1)12/h1-6,11-15H,(H4,8,9,10)/p+1/t1?,2-,3+,4+,5-,6? |
| InChIKey | LXQDZCCPYLOHOJ-UYSNGIAKSA-O |
| XLogP | -6.47 |
| TPSA | 167.16 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.22 |
| LogP ≤ 5 | -6.47 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|