About 4-azaniumylhex-5-enoate
4-azaniumylhex-5-enoate (PubChem CID 25202592) has the molecular formula C6H11NO2
and a molecular weight of 129.16 g/mol. Its IUPAC name is 4-azaniumylhex-5-enoate.
Molecular Properties
| Compound Name | 4-azaniumylhex-5-enoate |
| PubChem CID | 25202592 |
| Molecular Formula | C6H11NO2 |
| Molecular Weight | 129.16 g/mol |
| Exact Mass | 129.08 |
| IUPAC Name | 4-azaniumylhex-5-enoate |
| SMILES | C=CC([NH3+])CCC(=O)[O-] |
| InChI | InChI=1S/C6H11NO2/c1-2-5(7)3-4-6(8)9/h2,5H,1,3-4,7H2,(H,8,9) |
| InChIKey | PJDFLNIOAUIZSL-UHFFFAOYSA-N |
| XLogP | -1.69 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.16 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-azaniumylhex-5-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-azaniumylhex-5-enoate?
The IUPAC name of 4-azaniumylhex-5-enoate (CID 25202592) is 4-azaniumylhex-5-enoate.
What is the SMILES notation for 4-azaniumylhex-5-enoate?
The canonical SMILES for 4-azaniumylhex-5-enoate is C=CC([NH3+])CCC(=O)[O-].
What is the InChIKey of 4-azaniumylhex-5-enoate?
The InChIKey is PJDFLNIOAUIZSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO2/c1-2-5(7)3-4-6(8)9/h2,5H,1,3-4,7H2,(H,8,9).
What are the key properties of 4-azaniumylhex-5-enoate?
4-azaniumylhex-5-enoate has a molecular weight of 129.16 g/mol, XLogP of -1.69, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-azaniumylhex-5-enoate is sourced from PubChem (CID 25202592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).