C25H35O4- — CID 25202889
5-hydroxy-4,4,6-tris(3-methylbut-2-enyl)-2-(2-methylpropanoyl)-3-oxocyclohexa-1,5-dien-1-olate (PubChem CID 25202889) has the molecular formula C25H35O4- and a molecular weight of 399.55 g/mol. Its IUPAC name is 5-hydroxy-4,4,6-tris(3-methylbut-2-enyl)-2-(2-methylpropanoyl)-3-oxocyclohexa-1,5-dien-1-olate.
| Compound Name | 5-hydroxy-4,4,6-tris(3-methylbut-2-enyl)-2-(2-methylpropanoyl)-3-oxocyclohexa-1,5-dien-1-olate |
|---|---|
| PubChem CID | 25202889 |
| Molecular Formula | C25H35O4- |
| Molecular Weight | 399.55 g/mol |
| Exact Mass | 399.25 |
| IUPAC Name | 5-hydroxy-4,4,6-tris(3-methylbut-2-enyl)-2-(2-methylpropanoyl)-3-oxocyclohexa-1,5-dien-1-olate |
| SMILES | CC(C)=CCC1=C(O)C(CC=C(C)C)(CC=C(C)C)C(=O)C(C(=O)C(C)C)=C1[O-] |
| InChI | InChI=1S/C25H36O4/c1-15(2)9-10-19-22(27)20(21(26)18(7)8)24(29)25(23(19)28,13-11-16(3)4)14-12-17(5)6/h9,11-12,18,27-28H,10,13-14H2,1-8H3/p-1 |
| InChIKey | UNCDMWKTFLUPHZ-UHFFFAOYSA-M |
| XLogP | 5.28 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.55 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|