About 1-(1H-indol-3-yl)ethane-1,2-diol
1-(1H-indol-3-yl)ethane-1,2-diol (PubChem CID 25202910) has the molecular formula C10H11NO2
and a molecular weight of 177.20 g/mol. Its IUPAC name is 1-(1H-indol-3-yl)ethane-1,2-diol.
Molecular Properties
| Compound Name | 1-(1H-indol-3-yl)ethane-1,2-diol |
| PubChem CID | 25202910 |
| Molecular Formula | C10H11NO2 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | 1-(1H-indol-3-yl)ethane-1,2-diol |
| SMILES | OCC(O)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C10H11NO2/c12-6-10(13)8-5-11-9-4-2-1-3-7(8)9/h1-5,10-13H,6H2 |
| InChIKey | XNJDZRGYWQBBMZ-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 56.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(1H-indol-3-yl)ethane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1H-indol-3-yl)ethane-1,2-diol?
The IUPAC name of 1-(1H-indol-3-yl)ethane-1,2-diol (CID 25202910) is 1-(1H-indol-3-yl)ethane-1,2-diol.
What is the SMILES notation for 1-(1H-indol-3-yl)ethane-1,2-diol?
The canonical SMILES for 1-(1H-indol-3-yl)ethane-1,2-diol is OCC(O)c1c[nH]c2ccccc12.
What is the InChIKey of 1-(1H-indol-3-yl)ethane-1,2-diol?
The InChIKey is XNJDZRGYWQBBMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO2/c12-6-10(13)8-5-11-9-4-2-1-3-7(8)9/h1-5,10-13H,6H2.
What are the key properties of 1-(1H-indol-3-yl)ethane-1,2-diol?
1-(1H-indol-3-yl)ethane-1,2-diol has a molecular weight of 177.20 g/mol, XLogP of 1.19, 2 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1H-indol-3-yl)ethane-1,2-diol is sourced from PubChem (CID 25202910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).