C7H9O8P-2 — CID 25203322
[(4R,5S,6R)-4,5,6-trihydroxy-3-oxocyclohexen-1-yl]methyl phosphate (PubChem CID 25203322) has the molecular formula C7H9O8P-2 and a molecular weight of 252.11 g/mol. Its IUPAC name is [(4R,5S,6R)-4,5,6-trihydroxy-3-oxocyclohexen-1-yl]methyl phosphate.
| Compound Name | [(4R,5S,6R)-4,5,6-trihydroxy-3-oxocyclohexen-1-yl]methyl phosphate |
|---|---|
| PubChem CID | 25203322 |
| Molecular Formula | C7H9O8P-2 |
| Molecular Weight | 252.11 g/mol |
| Exact Mass | 252.00 |
| IUPAC Name | [(4R,5S,6R)-4,5,6-trihydroxy-3-oxocyclohexen-1-yl]methyl phosphate |
| SMILES | O=C1C=C(COP(=O)([O-])[O-])[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C7H11O8P/c8-4-1-3(2-15-16(12,13)14)5(9)7(11)6(4)10/h1,5-7,9-11H,2H2,(H2,12,13,14)/p-2/t5-,6+,7+/m1/s1 |
| InChIKey | OIBXQBFLSXHTEZ-VQVTYTSYSA-L |
| XLogP | -3.58 |
| TPSA | 150.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.11 |
| LogP ≤ 5 | -3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|