C10H13O4- — CID 25203532
(1R,4aS,7S,7aR)-1-hydroxy-7-methyl-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylate (PubChem CID 25203532) has the molecular formula C10H13O4- and a molecular weight of 197.21 g/mol. Its IUPAC name is (1R,4aS,7S,7aR)-1-hydroxy-7-methyl-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylate.
| Compound Name | (1R,4aS,7S,7aR)-1-hydroxy-7-methyl-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylate |
|---|---|
| PubChem CID | 25203532 |
| Molecular Formula | C10H13O4- |
| Molecular Weight | 197.21 g/mol |
| Exact Mass | 197.08 |
| IUPAC Name | (1R,4aS,7S,7aR)-1-hydroxy-7-methyl-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylate |
| SMILES | C[C@H]1CC[C@@H]2C(C(=O)[O-])=CO[C@@H](O)[C@@H]21 |
| InChI | InChI=1S/C10H14O4/c1-5-2-3-6-7(9(11)12)4-14-10(13)8(5)6/h4-6,8,10,13H,2-3H2,1H3,(H,11,12)/p-1/t5-,6+,8+,10+/m0/s1 |
| InChIKey | DKGYTSKPMLWLEI-FIZOKRMRSA-M |
| XLogP | -0.37 |
| TPSA | 69.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.21 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |