About 2-[[2-(2-oxo-1,3-dihydroindol-3-yl)acetyl]amino]butanedioate
2-[[2-(2-oxo-1,3-dihydroindol-3-yl)acetyl]amino]butanedioate (PubChem CID 25203582) has the molecular formula C14H12N2O6-2
and a molecular weight of 304.26 g/mol. Its IUPAC name is 2-[[2-(2-oxo-1,3-dihydroindol-3-yl)acetyl]amino]butanedioate.
Molecular Properties
| Compound Name | 2-[[2-(2-oxo-1,3-dihydroindol-3-yl)acetyl]amino]butanedioate |
| PubChem CID | 25203582 |
| Molecular Formula | C14H12N2O6-2 |
| Molecular Weight | 304.26 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | 2-[[2-(2-oxo-1,3-dihydroindol-3-yl)acetyl]amino]butanedioate |
| SMILES | O=C([O-])CC(NC(=O)CC1C(=O)Nc2ccccc21)C(=O)[O-] |
| InChI | InChI=1S/C14H14N2O6/c17-11(15-10(14(21)22)6-12(18)19)5-8-7-3-1-2-4-9(7)16-13(8)20/h1-4,8,10H,5-6H2,(H,15,17)(H,16,20)(H,18,19)(H,21,22)/p-2 |
| InChIKey | SDOOMIWSQMGJCL-UHFFFAOYSA-L |
| XLogP | -2.51 |
| TPSA | 138.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.26 |
| LogP ≤ 5 | -2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[[2-(2-oxo-1,3-dihydroindol-3-yl)acetyl]amino]butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2-(2-oxo-1,3-dihydroindol-3-yl)acetyl]amino]butanedioate?
The IUPAC name of 2-[[2-(2-oxo-1,3-dihydroindol-3-yl)acetyl]amino]butanedioate (CID 25203582) is 2-[[2-(2-oxo-1,3-dihydroindol-3-yl)acetyl]amino]butanedioate.
What is the SMILES notation for 2-[[2-(2-oxo-1,3-dihydroindol-3-yl)acetyl]amino]butanedioate?
The canonical SMILES for 2-[[2-(2-oxo-1,3-dihydroindol-3-yl)acetyl]amino]butanedioate is O=C([O-])CC(NC(=O)CC1C(=O)Nc2ccccc21)C(=O)[O-].
What is the InChIKey of 2-[[2-(2-oxo-1,3-dihydroindol-3-yl)acetyl]amino]butanedioate?
The InChIKey is SDOOMIWSQMGJCL-UHFFFAOYSA-L. The full InChI is InChI=1S/C14H14N2O6/c17-11(15-10(14(21)22)6-12(18)19)5-8-7-3-1-2-4-9(7)16-13(8)20/h1-4,8,10H,5-6H2,(H,15,17)(H,16,20)(H,18,19)(H,21,22)/p-2.
What are the key properties of 2-[[2-(2-oxo-1,3-dihydroindol-3-yl)acetyl]amino]butanedioate?
2-[[2-(2-oxo-1,3-dihydroindol-3-yl)acetyl]amino]butanedioate has a molecular weight of 304.26 g/mol, XLogP of -2.51, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2-(2-oxo-1,3-dihydroindol-3-yl)acetyl]amino]butanedioate is sourced from PubChem (CID 25203582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).