About 2-hydroxy-2H-pyran-4,6-dicarboxylate
2-hydroxy-2H-pyran-4,6-dicarboxylate (PubChem CID 25203591) has the molecular formula C7H4O6-2
and a molecular weight of 184.10 g/mol. Its IUPAC name is 2-hydroxy-2H-pyran-4,6-dicarboxylate.
Molecular Properties
| Compound Name | 2-hydroxy-2H-pyran-4,6-dicarboxylate |
| PubChem CID | 25203591 |
| Molecular Formula | C7H4O6-2 |
| Molecular Weight | 184.10 g/mol |
| Exact Mass | 184.00 |
| IUPAC Name | 2-hydroxy-2H-pyran-4,6-dicarboxylate |
| SMILES | O=C([O-])C1=CC(O)OC(C(=O)[O-])=C1 |
| InChI | InChI=1S/C7H6O6/c8-5-2-3(6(9)10)1-4(13-5)7(11)12/h1-2,5,8H,(H,9,10)(H,11,12)/p-2 |
| InChIKey | MLOJGZHQNWCBAC-UHFFFAOYSA-L |
| XLogP | -3.35 |
| TPSA | 109.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.10 |
| LogP ≤ 5 | -3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-hydroxy-2H-pyran-4,6-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-2H-pyran-4,6-dicarboxylate?
The IUPAC name of 2-hydroxy-2H-pyran-4,6-dicarboxylate (CID 25203591) is 2-hydroxy-2H-pyran-4,6-dicarboxylate.
What is the SMILES notation for 2-hydroxy-2H-pyran-4,6-dicarboxylate?
The canonical SMILES for 2-hydroxy-2H-pyran-4,6-dicarboxylate is O=C([O-])C1=CC(O)OC(C(=O)[O-])=C1.
What is the InChIKey of 2-hydroxy-2H-pyran-4,6-dicarboxylate?
The InChIKey is MLOJGZHQNWCBAC-UHFFFAOYSA-L. The full InChI is InChI=1S/C7H6O6/c8-5-2-3(6(9)10)1-4(13-5)7(11)12/h1-2,5,8H,(H,9,10)(H,11,12)/p-2.
What are the key properties of 2-hydroxy-2H-pyran-4,6-dicarboxylate?
2-hydroxy-2H-pyran-4,6-dicarboxylate has a molecular weight of 184.10 g/mol, XLogP of -3.35, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-2H-pyran-4,6-dicarboxylate is sourced from PubChem (CID 25203591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).