C26H27FN4O2 — CID 25204213
(3R)-3-[5-(4-fluoro-3-methoxyphenyl)-1H-imidazol-2-yl]-1-(oxan-4-yl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole (PubChem CID 25204213) has the molecular formula C26H27FN4O2 and a molecular weight of 446.53 g/mol. Its IUPAC name is (3R)-3-[5-(4-fluoro-3-methoxyphenyl)-1H-imidazol-2-yl]-1-(oxan-4-yl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole.
| Compound Name | (3R)-3-[5-(4-fluoro-3-methoxyphenyl)-1H-imidazol-2-yl]-1-(oxan-4-yl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole |
|---|---|
| PubChem CID | 25204213 |
| Molecular Formula | C26H27FN4O2 |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | (3R)-3-[5-(4-fluoro-3-methoxyphenyl)-1H-imidazol-2-yl]-1-(oxan-4-yl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole |
| SMILES | COc1cc(-c2cnc([C@H]3Cc4c([nH]c5ccccc45)C(C4CCOCC4)N3)[nH]2)ccc1F |
| InChI | InChI=1S/C26H27FN4O2/c1-32-23-12-16(6-7-19(23)27)22-14-28-26(31-22)21-13-18-17-4-2-3-5-20(17)29-25(18)24(30-21)15-8-10-33-11-9-15/h2-7,12,14-15,21,24,29-30H,8-11,13H2,1H3,(H,28,31)/t21-,24?/m1/s1 |
| InChIKey | QERATWAKFBMKPB-CILPGNKCSA-N |
| XLogP | 5.06 |
| TPSA | 74.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|