C25H21F2N5S — CID 25204214
5-[7-fluoro-3-[5-(4-fluorophenyl)-1H-imidazol-2-yl]-3-methyl-1,2,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-2-methyl-1,3-thiazole (PubChem CID 25204214) has the molecular formula C25H21F2N5S and a molecular weight of 461.54 g/mol. Its IUPAC name is 5-[7-fluoro-3-[5-(4-fluorophenyl)-1H-imidazol-2-yl]-3-methyl-1,2,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-2-methyl-1,3-thiazole.
| Compound Name | 5-[7-fluoro-3-[5-(4-fluorophenyl)-1H-imidazol-2-yl]-3-methyl-1,2,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-2-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 25204214 |
| Molecular Formula | C25H21F2N5S |
| Molecular Weight | 461.54 g/mol |
| Exact Mass | 461.15 |
| IUPAC Name | 5-[7-fluoro-3-[5-(4-fluorophenyl)-1H-imidazol-2-yl]-3-methyl-1,2,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-2-methyl-1,3-thiazole |
| SMILES | Cc1ncc(C2NC(C)(c3ncc(-c4ccc(F)cc4)[nH]3)Cc3c2[nH]c2cc(F)ccc32)s1 |
| InChI | InChI=1S/C25H21F2N5S/c1-13-28-12-21(33-13)23-22-18(17-8-7-16(27)9-19(17)30-22)10-25(2,32-23)24-29-11-20(31-24)14-3-5-15(26)6-4-14/h3-9,11-12,23,30,32H,10H2,1-2H3,(H,29,31) |
| InChIKey | FLIKDZAUTRHERJ-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.54 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|