C27H29N5O2 — CID 25204216
methyl 4-[(3R)-3-(5-phenyl-1H-imidazol-2-yl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl]piperidine-1-carboxylate (PubChem CID 25204216) has the molecular formula C27H29N5O2 and a molecular weight of 455.56 g/mol. Its IUPAC name is methyl 4-[(3R)-3-(5-phenyl-1H-imidazol-2-yl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl]piperidine-1-carboxylate.
| Compound Name | methyl 4-[(3R)-3-(5-phenyl-1H-imidazol-2-yl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 25204216 |
| Molecular Formula | C27H29N5O2 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.23 |
| IUPAC Name | methyl 4-[(3R)-3-(5-phenyl-1H-imidazol-2-yl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl]piperidine-1-carboxylate |
| SMILES | COC(=O)N1CCC(C2N[C@@H](c3ncc(-c4ccccc4)[nH]3)Cc3c2[nH]c2ccccc32)CC1 |
| InChI | InChI=1S/C27H29N5O2/c1-34-27(33)32-13-11-18(12-14-32)24-25-20(19-9-5-6-10-21(19)29-25)15-22(30-24)26-28-16-23(31-26)17-7-3-2-4-8-17/h2-10,16,18,22,24,29-30H,11-15H2,1H3,(H,28,31)/t22-,24?/m1/s1 |
| InChIKey | WLWPJGTZCVDLGP-LETIRJCYSA-N |
| XLogP | 4.96 |
| TPSA | 86.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|