C15H17ClFNO4S — CID 25204235
ethyl (6R)-6-[(2-chloro-3,5,6-trideuterio-4-fluorophenyl)sulfamoyl]-2,4,4,6-tetradeuteriocyclohexene-1-carboxylate (PubChem CID 25204235) has the molecular formula C15H17ClFNO4S and a molecular weight of 368.86 g/mol. Its IUPAC name is ethyl (6R)-6-[(2-chloro-3,5,6-trideuterio-4-fluorophenyl)sulfamoyl]-2,4,4,6-tetradeuteriocyclohexene-1-carboxylate.
| Compound Name | ethyl (6R)-6-[(2-chloro-3,5,6-trideuterio-4-fluorophenyl)sulfamoyl]-2,4,4,6-tetradeuteriocyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 25204235 |
| Molecular Formula | C15H17ClFNO4S |
| Molecular Weight | 368.86 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | ethyl (6R)-6-[(2-chloro-3,5,6-trideuterio-4-fluorophenyl)sulfamoyl]-2,4,4,6-tetradeuteriocyclohexene-1-carboxylate |
| SMILES | [2H]C1=C(C(=O)OCC)[C@]([2H])(S(=O)(=O)Nc2c([2H])c([2H])c(F)c([2H])c2Cl)CC([2H])([2H])C1 |
| InChI | InChI=1S/C15H17ClFNO4S/c1-2-22-15(19)11-5-3-4-6-14(11)23(20,21)18-13-8-7-10(17)9-12(13)16/h5,7-9,14,18H,2-4,6H2,1H3/t14-/m1/s1/i4D2,5D,7D,8D,9D,14D |
| InChIKey | LEEIJTHMHDMWLJ-IQQSWXHISA-N |
| XLogP | 3.26 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.86 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |