C15H13F3N4O3 — CID 25204259
2-hydroxy-N-[(Z)-[1,1,1-trifluoro-4-(2-methylpyrazol-3-yl)-4-oxobutan-2-ylidene]amino]benzamide (PubChem CID 25204259) has the molecular formula C15H13F3N4O3 and a molecular weight of 354.29 g/mol. Its IUPAC name is 2-hydroxy-N-[(Z)-[1,1,1-trifluoro-4-(2-methylpyrazol-3-yl)-4-oxobutan-2-ylidene]amino]benzamide.
| Compound Name | 2-hydroxy-N-[(Z)-[1,1,1-trifluoro-4-(2-methylpyrazol-3-yl)-4-oxobutan-2-ylidene]amino]benzamide |
|---|---|
| PubChem CID | 25204259 |
| Molecular Formula | C15H13F3N4O3 |
| Molecular Weight | 354.29 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | 2-hydroxy-N-[(Z)-[1,1,1-trifluoro-4-(2-methylpyrazol-3-yl)-4-oxobutan-2-ylidene]amino]benzamide |
| SMILES | Cn1nccc1C(=O)C/C(=N/NC(=O)c1ccccc1O)C(F)(F)F |
| InChI | InChI=1S/C15H13F3N4O3/c1-22-10(6-7-19-22)12(24)8-13(15(16,17)18)20-21-14(25)9-4-2-3-5-11(9)23/h2-7,23H,8H2,1H3,(H,21,25)/b20-13- |
| InChIKey | GZBJUOZORBGHOE-MOSHPQCFSA-N |
| XLogP | 2.05 |
| TPSA | 96.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.29 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|