C14H13FN6S — CID 25204322
3-[1-(cyclopropylmethyl)pyrazol-4-yl]-N-(6-fluoro-2-pyridinyl)-1,2,4-thiadiazol-5-amine (PubChem CID 25204322) has the molecular formula C14H13FN6S and a molecular weight of 316.37 g/mol. Its IUPAC name is 3-[1-(cyclopropylmethyl)pyrazol-4-yl]-N-(6-fluoro-2-pyridinyl)-1,2,4-thiadiazol-5-amine.
| Compound Name | 3-[1-(cyclopropylmethyl)pyrazol-4-yl]-N-(6-fluoro-2-pyridinyl)-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 25204322 |
| Molecular Formula | C14H13FN6S |
| Molecular Weight | 316.37 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | 3-[1-(cyclopropylmethyl)pyrazol-4-yl]-N-(6-fluoro-2-pyridinyl)-1,2,4-thiadiazol-5-amine |
| SMILES | Fc1cccc(Nc2nc(-c3cnn(CC4CC4)c3)ns2)n1 |
| InChI | InChI=1S/C14H13FN6S/c15-11-2-1-3-12(17-11)18-14-19-13(20-22-14)10-6-16-21(8-10)7-9-4-5-9/h1-3,6,8-9H,4-5,7H2,(H,17,18,19,20) |
| InChIKey | REUGXUPNAUIYHR-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.37 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|