C15H15BrN4O3 — CID 25204486
3'-bromospiro[1,3-diazinane-5,6'-5,6a,7,8,9,10-hexahydropyrido[1,2-a][1,8]naphthyridine]-2,4,6-trione (PubChem CID 25204486) has the molecular formula C15H15BrN4O3 and a molecular weight of 379.21 g/mol. Its IUPAC name is 3'-bromospiro[1,3-diazinane-5,6'-5,6a,7,8,9,10-hexahydropyrido[1,2-a][1,8]naphthyridine]-2,4,6-trione.
| Compound Name | 3'-bromospiro[1,3-diazinane-5,6'-5,6a,7,8,9,10-hexahydropyrido[1,2-a][1,8]naphthyridine]-2,4,6-trione |
|---|---|
| PubChem CID | 25204486 |
| Molecular Formula | C15H15BrN4O3 |
| Molecular Weight | 379.21 g/mol |
| Exact Mass | 378.03 |
| IUPAC Name | 3'-bromospiro[1,3-diazinane-5,6'-5,6a,7,8,9,10-hexahydropyrido[1,2-a][1,8]naphthyridine]-2,4,6-trione |
| SMILES | O=C1NC(=O)C2(Cc3cc(Br)cnc3N3CCCCC32)C(=O)N1 |
| InChI | InChI=1S/C15H15BrN4O3/c16-9-5-8-6-15(12(21)18-14(23)19-13(15)22)10-3-1-2-4-20(10)11(8)17-7-9/h5,7,10H,1-4,6H2,(H2,18,19,21,22,23) |
| InChIKey | NSBZXHPYZFSMNO-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.21 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|