C17H19BrN4O3 — CID 25204487
(6'aR,7'R)-3'-bromo-7',9'-dimethylspiro[1,3-diazinane-5,6'-5,6a,7,8,9,10-hexahydropyrido[1,2-a][1,8]naphthyridine]-2,4,6-trione (PubChem CID 25204487) has the molecular formula C17H19BrN4O3 and a molecular weight of 407.27 g/mol. Its IUPAC name is (6'aR,7'R)-3'-bromo-7',9'-dimethylspiro[1,3-diazinane-5,6'-5,6a,7,8,9,10-hexahydropyrido[1,2-a][1,8]naphthyridine]-2,4,6-trione.
| Compound Name | (6'aR,7'R)-3'-bromo-7',9'-dimethylspiro[1,3-diazinane-5,6'-5,6a,7,8,9,10-hexahydropyrido[1,2-a][1,8]naphthyridine]-2,4,6-trione |
|---|---|
| PubChem CID | 25204487 |
| Molecular Formula | C17H19BrN4O3 |
| Molecular Weight | 407.27 g/mol |
| Exact Mass | 406.06 |
| IUPAC Name | (6'aR,7'R)-3'-bromo-7',9'-dimethylspiro[1,3-diazinane-5,6'-5,6a,7,8,9,10-hexahydropyrido[1,2-a][1,8]naphthyridine]-2,4,6-trione |
| SMILES | CC1C[C@@H](C)[C@H]2N(C1)c1ncc(Br)cc1CC21C(=O)NC(=O)NC1=O |
| InChI | InChI=1S/C17H19BrN4O3/c1-8-3-9(2)12-17(14(23)20-16(25)21-15(17)24)5-10-4-11(18)6-19-13(10)22(12)7-8/h4,6,8-9,12H,3,5,7H2,1-2H3,(H2,20,21,23,24,25)/t8?,9-,12-/m1/s1 |
| InChIKey | PQFMGKVLTMJSDJ-LHYZIERNSA-N |
| XLogP | 1.60 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.27 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|