About (3-methylimidazol-4-yl)methyl N-[3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazol-4-yl]carbamate
(3-methylimidazol-4-yl)methyl N-[3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazol-4-yl]carbamate (PubChem CID 25204532) has the molecular formula C16H14Cl2N4O3
and a molecular weight of 381.22 g/mol. Its IUPAC name is (3-methylimidazol-4-yl)methyl N-[3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazol-4-yl]carbamate.
Molecular Properties
| Compound Name | (3-methylimidazol-4-yl)methyl N-[3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazol-4-yl]carbamate |
| PubChem CID | 25204532 |
| Molecular Formula | C16H14Cl2N4O3 |
| Molecular Weight | 381.22 g/mol |
| Exact Mass | 380.04 |
| IUPAC Name | (3-methylimidazol-4-yl)methyl N-[3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazol-4-yl]carbamate |
| SMILES | Cc1onc(-c2c(Cl)cccc2Cl)c1NC(=O)OCc1cncn1C |
| InChI | InChI=1S/C16H14Cl2N4O3/c1-9-14(20-16(23)24-7-10-6-19-8-22(10)2)15(21-25-9)13-11(17)4-3-5-12(13)18/h3-6,8H,7H2,1-2H3,(H,20,23) |
| InChIKey | LSKXTENDSNLCBM-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 82.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.22 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (3-methylimidazol-4-yl)methyl N-[3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazol-4-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methylimidazol-4-yl)methyl N-[3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazol-4-yl]carbamate?
The IUPAC name of (3-methylimidazol-4-yl)methyl N-[3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazol-4-yl]carbamate (CID 25204532) is (3-methylimidazol-4-yl)methyl N-[3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazol-4-yl]carbamate.
What is the SMILES notation for (3-methylimidazol-4-yl)methyl N-[3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazol-4-yl]carbamate?
The canonical SMILES for (3-methylimidazol-4-yl)methyl N-[3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazol-4-yl]carbamate is Cc1onc(-c2c(Cl)cccc2Cl)c1NC(=O)OCc1cncn1C.
What is the InChIKey of (3-methylimidazol-4-yl)methyl N-[3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazol-4-yl]carbamate?
The InChIKey is LSKXTENDSNLCBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14Cl2N4O3/c1-9-14(20-16(23)24-7-10-6-19-8-22(10)2)15(21-25-9)13-11(17)4-3-5-12(13)18/h3-6,8H,7H2,1-2H3,(H,20,23).
What are the key properties of (3-methylimidazol-4-yl)methyl N-[3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazol-4-yl]carbamate?
(3-methylimidazol-4-yl)methyl N-[3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazol-4-yl]carbamate has a molecular weight of 381.22 g/mol, XLogP of 4.44, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methylimidazol-4-yl)methyl N-[3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazol-4-yl]carbamate is sourced from PubChem (CID 25204532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).