C20H14F5NO3 — CID 25204745
(4S)-4-benzyl-3-[(E)-3-(3,5-difluorophenyl)-4,4,4-trifluorobut-2-enoyl]-1,3-oxazolidin-2-one (PubChem CID 25204745) has the molecular formula C20H14F5NO3 and a molecular weight of 411.33 g/mol. Its IUPAC name is (4S)-4-benzyl-3-[(E)-3-(3,5-difluorophenyl)-4,4,4-trifluorobut-2-enoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-benzyl-3-[(E)-3-(3,5-difluorophenyl)-4,4,4-trifluorobut-2-enoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 25204745 |
| Molecular Formula | C20H14F5NO3 |
| Molecular Weight | 411.33 g/mol |
| Exact Mass | 411.09 |
| IUPAC Name | (4S)-4-benzyl-3-[(E)-3-(3,5-difluorophenyl)-4,4,4-trifluorobut-2-enoyl]-1,3-oxazolidin-2-one |
| SMILES | O=C(/C=C(\c1cc(F)cc(F)c1)C(F)(F)F)N1C(=O)OC[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C20H14F5NO3/c21-14-7-13(8-15(22)9-14)17(20(23,24)25)10-18(27)26-16(11-29-19(26)28)6-12-4-2-1-3-5-12/h1-5,7-10,16H,6,11H2/b17-10+/t16-/m0/s1 |
| InChIKey | GRCOBZMLUABWBK-KFXAOSDLSA-N |
| XLogP | 4.50 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.33 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|