C20H15F5N4O3 — CID 25205013
(4S)-3-[(2S,3R)-2-azido-3-(3,5-difluorophenyl)-4,4,4-trifluorobutanoyl]-4-benzyl-1,3-oxazolidin-2-one (PubChem CID 25205013) has the molecular formula C20H15F5N4O3 and a molecular weight of 454.36 g/mol. Its IUPAC name is (4S)-3-[(2S,3R)-2-azido-3-(3,5-difluorophenyl)-4,4,4-trifluorobutanoyl]-4-benzyl-1,3-oxazolidin-2-one.
| Compound Name | (4S)-3-[(2S,3R)-2-azido-3-(3,5-difluorophenyl)-4,4,4-trifluorobutanoyl]-4-benzyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 25205013 |
| Molecular Formula | C20H15F5N4O3 |
| Molecular Weight | 454.36 g/mol |
| Exact Mass | 454.11 |
| IUPAC Name | (4S)-3-[(2S,3R)-2-azido-3-(3,5-difluorophenyl)-4,4,4-trifluorobutanoyl]-4-benzyl-1,3-oxazolidin-2-one |
| SMILES | [N-]=[N+]=N[C@H](C(=O)N1C(=O)OC[C@@H]1Cc1ccccc1)[C@@H](c1cc(F)cc(F)c1)C(F)(F)F |
| InChI | InChI=1S/C20H15F5N4O3/c21-13-7-12(8-14(22)9-13)16(20(23,24)25)17(27-28-26)18(30)29-15(10-32-19(29)31)6-11-4-2-1-3-5-11/h1-5,7-9,15-17H,6,10H2/t15-,16+,17-/m0/s1 |
| InChIKey | HOSMNOALAMZQET-BBWFWOEESA-N |
| XLogP | 4.88 |
| TPSA | 95.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.36 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|