C16H18BrNO — CID 25205282
2-bromo-3-[4-(dimethylamino)phenyl]-4,5,6,6a-tetrahydro-3aH-pentalen-1-one (PubChem CID 25205282) has the molecular formula C16H18BrNO and a molecular weight of 320.23 g/mol. Its IUPAC name is 2-bromo-3-[4-(dimethylamino)phenyl]-4,5,6,6a-tetrahydro-3aH-pentalen-1-one.
| Compound Name | 2-bromo-3-[4-(dimethylamino)phenyl]-4,5,6,6a-tetrahydro-3aH-pentalen-1-one |
|---|---|
| PubChem CID | 25205282 |
| Molecular Formula | C16H18BrNO |
| Molecular Weight | 320.23 g/mol |
| Exact Mass | 319.06 |
| IUPAC Name | 2-bromo-3-[4-(dimethylamino)phenyl]-4,5,6,6a-tetrahydro-3aH-pentalen-1-one |
| SMILES | CN(C)c1ccc(C2=C(Br)C(=O)C3CCCC23)cc1 |
| InChI | InChI=1S/C16H18BrNO/c1-18(2)11-8-6-10(7-9-11)14-12-4-3-5-13(12)16(19)15(14)17/h6-9,12-13H,3-5H2,1-2H3 |
| InChIKey | DXVLVUWKMRRXDK-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.23 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|