About 1-[(3-fluorophenyl)methyl]-3-[4-(methylsulfonylmethyl)-1,3-thiazol-2-yl]urea
1-[(3-fluorophenyl)methyl]-3-[4-(methylsulfonylmethyl)-1,3-thiazol-2-yl]urea (PubChem CID 25205670) has the molecular formula C13H14FN3O3S2
and a molecular weight of 343.41 g/mol. Its IUPAC name is 1-[(3-fluorophenyl)methyl]-3-[4-(methylsulfonylmethyl)-1,3-thiazol-2-yl]urea.
Molecular Properties
| Compound Name | 1-[(3-fluorophenyl)methyl]-3-[4-(methylsulfonylmethyl)-1,3-thiazol-2-yl]urea |
| PubChem CID | 25205670 |
| Molecular Formula | C13H14FN3O3S2 |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.05 |
| IUPAC Name | 1-[(3-fluorophenyl)methyl]-3-[4-(methylsulfonylmethyl)-1,3-thiazol-2-yl]urea |
| SMILES | CS(=O)(=O)Cc1csc(NC(=O)NCc2cccc(F)c2)n1 |
| InChI | InChI=1S/C13H14FN3O3S2/c1-22(19,20)8-11-7-21-13(16-11)17-12(18)15-6-9-3-2-4-10(14)5-9/h2-5,7H,6,8H2,1H3,(H2,15,16,17,18) |
| InChIKey | CXPRWCWSBWSUOE-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[(3-fluorophenyl)methyl]-3-[4-(methylsulfonylmethyl)-1,3-thiazol-2-yl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3-fluorophenyl)methyl]-3-[4-(methylsulfonylmethyl)-1,3-thiazol-2-yl]urea?
The IUPAC name of 1-[(3-fluorophenyl)methyl]-3-[4-(methylsulfonylmethyl)-1,3-thiazol-2-yl]urea (CID 25205670) is 1-[(3-fluorophenyl)methyl]-3-[4-(methylsulfonylmethyl)-1,3-thiazol-2-yl]urea.
What is the SMILES notation for 1-[(3-fluorophenyl)methyl]-3-[4-(methylsulfonylmethyl)-1,3-thiazol-2-yl]urea?
The canonical SMILES for 1-[(3-fluorophenyl)methyl]-3-[4-(methylsulfonylmethyl)-1,3-thiazol-2-yl]urea is CS(=O)(=O)Cc1csc(NC(=O)NCc2cccc(F)c2)n1.
What is the InChIKey of 1-[(3-fluorophenyl)methyl]-3-[4-(methylsulfonylmethyl)-1,3-thiazol-2-yl]urea?
The InChIKey is CXPRWCWSBWSUOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14FN3O3S2/c1-22(19,20)8-11-7-21-13(16-11)17-12(18)15-6-9-3-2-4-10(14)5-9/h2-5,7H,6,8H2,1H3,(H2,15,16,17,18).
What are the key properties of 1-[(3-fluorophenyl)methyl]-3-[4-(methylsulfonylmethyl)-1,3-thiazol-2-yl]urea?
1-[(3-fluorophenyl)methyl]-3-[4-(methylsulfonylmethyl)-1,3-thiazol-2-yl]urea has a molecular weight of 343.41 g/mol, XLogP of 2.15, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3-fluorophenyl)methyl]-3-[4-(methylsulfonylmethyl)-1,3-thiazol-2-yl]urea is sourced from PubChem (CID 25205670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).