C26H31N3O3 — CID 25205730
(E)-N-hydroxy-3-[3-[(E)-3-oxo-3-[2-[[(3S,5R)-3,4,5-trimethylpiperazin-1-yl]methyl]phenyl]prop-1-enyl]phenyl]prop-2-enamide (PubChem CID 25205730) has the molecular formula C26H31N3O3 and a molecular weight of 433.55 g/mol. Its IUPAC name is (E)-N-hydroxy-3-[3-[(E)-3-oxo-3-[2-[[(3S,5R)-3,4,5-trimethylpiperazin-1-yl]methyl]phenyl]prop-1-enyl]phenyl]prop-2-enamide.
| Compound Name | (E)-N-hydroxy-3-[3-[(E)-3-oxo-3-[2-[[(3S,5R)-3,4,5-trimethylpiperazin-1-yl]methyl]phenyl]prop-1-enyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 25205730 |
| Molecular Formula | C26H31N3O3 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.24 |
| IUPAC Name | (E)-N-hydroxy-3-[3-[(E)-3-oxo-3-[2-[[(3S,5R)-3,4,5-trimethylpiperazin-1-yl]methyl]phenyl]prop-1-enyl]phenyl]prop-2-enamide |
| SMILES | C[C@@H]1CN(Cc2ccccc2C(=O)/C=C/c2cccc(/C=C/C(=O)NO)c2)C[C@H](C)N1C |
| InChI | InChI=1S/C26H31N3O3/c1-19-16-29(17-20(2)28(19)3)18-23-9-4-5-10-24(23)25(30)13-11-21-7-6-8-22(15-21)12-14-26(31)27-32/h4-15,19-20,32H,16-18H2,1-3H3,(H,27,31)/b13-11+,14-12+/t19-,20+ |
| InChIKey | DLWXVBXWGMBTGI-RSEWVQGVSA-N |
| XLogP | 3.63 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|