C12H11F6NO3S — CID 25206230
2-(3,4,5-trifluorophenyl)-2-(3,3,3-trifluoropropylsulfonyl)propanamide (PubChem CID 25206230) has the molecular formula C12H11F6NO3S and a molecular weight of 363.28 g/mol. Its IUPAC name is 2-(3,4,5-trifluorophenyl)-2-(3,3,3-trifluoropropylsulfonyl)propanamide.
| Compound Name | 2-(3,4,5-trifluorophenyl)-2-(3,3,3-trifluoropropylsulfonyl)propanamide |
|---|---|
| PubChem CID | 25206230 |
| Molecular Formula | C12H11F6NO3S |
| Molecular Weight | 363.28 g/mol |
| Exact Mass | 363.04 |
| IUPAC Name | 2-(3,4,5-trifluorophenyl)-2-(3,3,3-trifluoropropylsulfonyl)propanamide |
| SMILES | CC(C(N)=O)(c1cc(F)c(F)c(F)c1)S(=O)(=O)CCC(F)(F)F |
| InChI | InChI=1S/C12H11F6NO3S/c1-11(10(19)20,23(21,22)3-2-12(16,17)18)6-4-7(13)9(15)8(14)5-6/h4-5H,2-3H2,1H3,(H2,19,20) |
| InChIKey | QXYLMWUPQWGQEH-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.28 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|