C20H18ClN3O5S2 — CID 25206264
3-[amino-[6-chloro-4-methyl-2-oxo-7-(1,3-thiazol-2-yloxy)-6,7-dihydrochromen-3-yl]methyl]benzenesulfonamide (PubChem CID 25206264) has the molecular formula C20H18ClN3O5S2 and a molecular weight of 479.97 g/mol. Its IUPAC name is 3-[amino-[6-chloro-4-methyl-2-oxo-7-(1,3-thiazol-2-yloxy)-6,7-dihydrochromen-3-yl]methyl]benzenesulfonamide.
| Compound Name | 3-[amino-[6-chloro-4-methyl-2-oxo-7-(1,3-thiazol-2-yloxy)-6,7-dihydrochromen-3-yl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 25206264 |
| Molecular Formula | C20H18ClN3O5S2 |
| Molecular Weight | 479.97 g/mol |
| Exact Mass | 479.04 |
| IUPAC Name | 3-[amino-[6-chloro-4-methyl-2-oxo-7-(1,3-thiazol-2-yloxy)-6,7-dihydrochromen-3-yl]methyl]benzenesulfonamide |
| SMILES | Cc1c(C(N)c2cccc(S(N)(=O)=O)c2)c(=O)oc2c1=CC(Cl)C(Oc1nccs1)C=2 |
| InChI | InChI=1S/C20H18ClN3O5S2/c1-10-13-8-14(21)16(29-20-24-5-6-30-20)9-15(13)28-19(25)17(10)18(22)11-3-2-4-12(7-11)31(23,26)27/h2-9,14,16,18H,22H2,1H3,(H2,23,26,27) |
| InChIKey | ZSECCPWPVCAZTF-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 138.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.97 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|