C26H26N4O2 — CID 25206372
4-[[4-[2-(1H-indol-3-yl)ethyl]-2,3-dihydro-1,4-benzoxazin-7-yl]amino]-6,7-dihydro-5H-cyclopenta[b]pyridin-7-ol (PubChem CID 25206372) has the molecular formula C26H26N4O2 and a molecular weight of 426.52 g/mol. Its IUPAC name is 4-[[4-[2-(1H-indol-3-yl)ethyl]-2,3-dihydro-1,4-benzoxazin-7-yl]amino]-6,7-dihydro-5H-cyclopenta[b]pyridin-7-ol.
| Compound Name | 4-[[4-[2-(1H-indol-3-yl)ethyl]-2,3-dihydro-1,4-benzoxazin-7-yl]amino]-6,7-dihydro-5H-cyclopenta[b]pyridin-7-ol |
|---|---|
| PubChem CID | 25206372 |
| Molecular Formula | C26H26N4O2 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | 4-[[4-[2-(1H-indol-3-yl)ethyl]-2,3-dihydro-1,4-benzoxazin-7-yl]amino]-6,7-dihydro-5H-cyclopenta[b]pyridin-7-ol |
| SMILES | OC1CCc2c(Nc3ccc4c(c3)OCCN4CCc3c[nH]c4ccccc34)ccnc21 |
| InChI | InChI=1S/C26H26N4O2/c31-24-8-6-20-22(9-11-27-26(20)24)29-18-5-7-23-25(15-18)32-14-13-30(23)12-10-17-16-28-21-4-2-1-3-19(17)21/h1-5,7,9,11,15-16,24,28,31H,6,8,10,12-14H2,(H,27,29) |
| InChIKey | OICNNGQJJXUBER-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 73.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|