C24H23F4N7O — CID 25207625
3-[6-(4-methylpiperazin-1-yl)-3-pyridinyl]-N-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]imidazo[1,2-a]pyrazin-8-amine (PubChem CID 25207625) has the molecular formula C24H23F4N7O and a molecular weight of 501.49 g/mol. Its IUPAC name is 3-[6-(4-methylpiperazin-1-yl)-3-pyridinyl]-N-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]imidazo[1,2-a]pyrazin-8-amine.
| Compound Name | 3-[6-(4-methylpiperazin-1-yl)-3-pyridinyl]-N-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]imidazo[1,2-a]pyrazin-8-amine |
|---|---|
| PubChem CID | 25207625 |
| Molecular Formula | C24H23F4N7O |
| Molecular Weight | 501.49 g/mol |
| Exact Mass | 501.19 |
| IUPAC Name | 3-[6-(4-methylpiperazin-1-yl)-3-pyridinyl]-N-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]imidazo[1,2-a]pyrazin-8-amine |
| SMILES | CN1CCN(c2ccc(-c3cnc4c(Nc5cccc(OC(F)(F)C(F)F)c5)nccn34)cn2)CC1 |
| InChI | InChI=1S/C24H23F4N7O/c1-33-9-11-34(12-10-33)20-6-5-16(14-30-20)19-15-31-22-21(29-7-8-35(19)22)32-17-3-2-4-18(13-17)36-24(27,28)23(25)26/h2-8,13-15,23H,9-12H2,1H3,(H,29,32) |
| InChIKey | WPGUUDWNTBEVMB-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 70.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.49 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|