About 1-benzyl-2-[(Z)-2-(furan-2-yl)-1-nitroethenyl]-4,5-dihydroimidazole;hydrochloride
1-benzyl-2-[(Z)-2-(furan-2-yl)-1-nitroethenyl]-4,5-dihydroimidazole;hydrochloride (PubChem CID 25208081) has the molecular formula C16H16ClN3O3
and a molecular weight of 333.78 g/mol. Its IUPAC name is 1-benzyl-2-[(Z)-2-(furan-2-yl)-1-nitroethenyl]-4,5-dihydroimidazole;hydrochloride.
Molecular Properties
| Compound Name | 1-benzyl-2-[(Z)-2-(furan-2-yl)-1-nitroethenyl]-4,5-dihydroimidazole;hydrochloride |
| PubChem CID | 25208081 |
| Molecular Formula | C16H16ClN3O3 |
| Molecular Weight | 333.78 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | 1-benzyl-2-[(Z)-2-(furan-2-yl)-1-nitroethenyl]-4,5-dihydroimidazole;hydrochloride |
| SMILES | Cl.O=[N+]([O-])/C(=C\c1ccco1)C1=NCCN1Cc1ccccc1 |
| InChI | InChI=1S/C16H15N3O3.ClH/c20-19(21)15(11-14-7-4-10-22-14)16-17-8-9-18(16)12-13-5-2-1-3-6-13;/h1-7,10-11H,8-9,12H2;1H/b15-11-; |
| InChIKey | MGBOAOPWDNNYBS-PNCOJPCNSA-N |
| XLogP | 3.23 |
| TPSA | 71.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.78 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-benzyl-2-[(Z)-2-(furan-2-yl)-1-nitroethenyl]-4,5-dihydroimidazole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-2-[(Z)-2-(furan-2-yl)-1-nitroethenyl]-4,5-dihydroimidazole;hydrochloride?
The IUPAC name of 1-benzyl-2-[(Z)-2-(furan-2-yl)-1-nitroethenyl]-4,5-dihydroimidazole;hydrochloride (CID 25208081) is 1-benzyl-2-[(Z)-2-(furan-2-yl)-1-nitroethenyl]-4,5-dihydroimidazole;hydrochloride.
What is the SMILES notation for 1-benzyl-2-[(Z)-2-(furan-2-yl)-1-nitroethenyl]-4,5-dihydroimidazole;hydrochloride?
The canonical SMILES for 1-benzyl-2-[(Z)-2-(furan-2-yl)-1-nitroethenyl]-4,5-dihydroimidazole;hydrochloride is Cl.O=[N+]([O-])/C(=C\c1ccco1)C1=NCCN1Cc1ccccc1.
What is the InChIKey of 1-benzyl-2-[(Z)-2-(furan-2-yl)-1-nitroethenyl]-4,5-dihydroimidazole;hydrochloride?
The InChIKey is MGBOAOPWDNNYBS-PNCOJPCNSA-N. The full InChI is InChI=1S/C16H15N3O3.ClH/c20-19(21)15(11-14-7-4-10-22-14)16-17-8-9-18(16)12-13-5-2-1-3-6-13;/h1-7,10-11H,8-9,12H2;1H/b15-11-;.
What are the key properties of 1-benzyl-2-[(Z)-2-(furan-2-yl)-1-nitroethenyl]-4,5-dihydroimidazole;hydrochloride?
1-benzyl-2-[(Z)-2-(furan-2-yl)-1-nitroethenyl]-4,5-dihydroimidazole;hydrochloride has a molecular weight of 333.78 g/mol, XLogP of 3.23, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-2-[(Z)-2-(furan-2-yl)-1-nitroethenyl]-4,5-dihydroimidazole;hydrochloride is sourced from PubChem (CID 25208081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).