C18H32 — CID 25208646
5-butyl-1,4-ditert-butylcyclohexa-1,3-diene (PubChem CID 25208646) has the molecular formula C18H32 and a molecular weight of 248.45 g/mol. Its IUPAC name is 5-butyl-1,4-ditert-butylcyclohexa-1,3-diene.
| Compound Name | 5-butyl-1,4-ditert-butylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 25208646 |
| Molecular Formula | C18H32 |
| Molecular Weight | 248.45 g/mol |
| Exact Mass | 248.25 |
| IUPAC Name | 5-butyl-1,4-ditert-butylcyclohexa-1,3-diene |
| SMILES | CCCCC1CC(C(C)(C)C)=CC=C1C(C)(C)C |
| InChI | InChI=1S/C18H32/c1-8-9-10-14-13-15(17(2,3)4)11-12-16(14)18(5,6)7/h11-12,14H,8-10,13H2,1-7H3 |
| InChIKey | RHUYEBRKLWHEOJ-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.45 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |