C23H21BrN2O2 — CID 25209220
(1S,8S,12R,20R)-17-bromo-3-methyl-5-phenyl-7,13-dioxa-4,5-diazapentacyclo[10.7.1.02,6.08,20.014,19]icosa-2(6),3,14(19),15,17-pentaene (PubChem CID 25209220) has the molecular formula C23H21BrN2O2 and a molecular weight of 437.34 g/mol. Its IUPAC name is (1S,8S,12R,20R)-17-bromo-3-methyl-5-phenyl-7,13-dioxa-4,5-diazapentacyclo[10.7.1.02,6.08,20.014,19]icosa-2(6),3,14(19),15,17-pentaene.
| Compound Name | (1S,8S,12R,20R)-17-bromo-3-methyl-5-phenyl-7,13-dioxa-4,5-diazapentacyclo[10.7.1.02,6.08,20.014,19]icosa-2(6),3,14(19),15,17-pentaene |
|---|---|
| PubChem CID | 25209220 |
| Molecular Formula | C23H21BrN2O2 |
| Molecular Weight | 437.34 g/mol |
| Exact Mass | 436.08 |
| IUPAC Name | (1S,8S,12R,20R)-17-bromo-3-methyl-5-phenyl-7,13-dioxa-4,5-diazapentacyclo[10.7.1.02,6.08,20.014,19]icosa-2(6),3,14(19),15,17-pentaene |
| SMILES | Cc1nn(-c2ccccc2)c2c1[C@@H]1c3cc(Br)ccc3O[C@@H]3CCC[C@H](O2)[C@H]13 |
| InChI | InChI=1S/C23H21BrN2O2/c1-13-20-21-16-12-14(24)10-11-17(16)27-18-8-5-9-19(22(18)21)28-23(20)26(25-13)15-6-3-2-4-7-15/h2-4,6-7,10-12,18-19,21-22H,5,8-9H2,1H3/t18-,19+,21+,22-/m1/s1 |
| InChIKey | FNYHELBTERORII-XMGTWHOFSA-N |
| XLogP | 5.40 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.34 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |