C10H22O4S2 — CID 25209258
(2R,3R,4S,5S)-1,1-bis(ethylsulfanyl)hexane-2,3,4,5-tetrol (PubChem CID 25209258) has the molecular formula C10H22O4S2 and a molecular weight of 270.42 g/mol. Its IUPAC name is (2R,3R,4S,5S)-1,1-bis(ethylsulfanyl)hexane-2,3,4,5-tetrol.
| Compound Name | (2R,3R,4S,5S)-1,1-bis(ethylsulfanyl)hexane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 25209258 |
| Molecular Formula | C10H22O4S2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | (2R,3R,4S,5S)-1,1-bis(ethylsulfanyl)hexane-2,3,4,5-tetrol |
| SMILES | CCSC(SCC)[C@H](O)[C@H](O)[C@@H](O)[C@H](C)O |
| InChI | InChI=1S/C10H22O4S2/c1-4-15-10(16-5-2)9(14)8(13)7(12)6(3)11/h6-14H,4-5H2,1-3H3/t6-,7-,8+,9+/m0/s1 |
| InChIKey | MKFOCLXLRFQETN-RBXMUDONSA-N |
| XLogP | 0.28 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|