C7H11N3O3 — CID 25209285
(3S,4R,5R)-3-azido-5-ethyl-4-methoxyoxolan-2-one (PubChem CID 25209285) has the molecular formula C7H11N3O3 and a molecular weight of 185.18 g/mol. Its IUPAC name is (3S,4R,5R)-3-azido-5-ethyl-4-methoxyoxolan-2-one.
| Compound Name | (3S,4R,5R)-3-azido-5-ethyl-4-methoxyoxolan-2-one |
|---|---|
| PubChem CID | 25209285 |
| Molecular Formula | C7H11N3O3 |
| Molecular Weight | 185.18 g/mol |
| Exact Mass | 185.08 |
| IUPAC Name | (3S,4R,5R)-3-azido-5-ethyl-4-methoxyoxolan-2-one |
| SMILES | CC[C@H]1OC(=O)[C@@H](N=[N+]=[N-])[C@H]1OC |
| InChI | InChI=1S/C7H11N3O3/c1-3-4-6(12-2)5(9-10-8)7(11)13-4/h4-6H,3H2,1-2H3/t4-,5+,6+/m1/s1 |
| InChIKey | MGKGULWZBIHAJA-SRQIZXRXSA-N |
| XLogP | 1.02 |
| TPSA | 84.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.18 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|