About 6-methoxy-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine
6-methoxy-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine (PubChem CID 25209511) has the molecular formula C8H12N2O
and a molecular weight of 152.20 g/mol. Its IUPAC name is 6-methoxy-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine.
Analyze 6-methoxy-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methoxy-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine?
The IUPAC name of 6-methoxy-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine (CID 25209511) is 6-methoxy-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine.
What is the SMILES notation for 6-methoxy-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine?
The canonical SMILES for 6-methoxy-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine is COC1CCc2nccn2C1.
What is the InChIKey of 6-methoxy-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine?
The InChIKey is BRZLVJBUJXQPJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O/c1-11-7-2-3-8-9-4-5-10(8)6-7/h4-5,7H,2-3,6H2,1H3.
What are the key properties of 6-methoxy-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine?
6-methoxy-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine has a molecular weight of 152.20 g/mol, XLogP of 0.84, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methoxy-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine is sourced from PubChem (CID 25209511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).