C22H42O2Si — CID 25209601
(3S,4S,5E,7S,8R,9E)-8-[tert-butyl(dimethyl)silyl]oxy-7-ethyl-3,5,9-trimethylundeca-1,5,9-trien-4-ol (PubChem CID 25209601) has the molecular formula C22H42O2Si and a molecular weight of 366.66 g/mol. Its IUPAC name is (3S,4S,5E,7S,8R,9E)-8-[tert-butyl(dimethyl)silyl]oxy-7-ethyl-3,5,9-trimethylundeca-1,5,9-trien-4-ol.
| Compound Name | (3S,4S,5E,7S,8R,9E)-8-[tert-butyl(dimethyl)silyl]oxy-7-ethyl-3,5,9-trimethylundeca-1,5,9-trien-4-ol |
|---|---|
| PubChem CID | 25209601 |
| Molecular Formula | C22H42O2Si |
| Molecular Weight | 366.66 g/mol |
| Exact Mass | 366.30 |
| IUPAC Name | (3S,4S,5E,7S,8R,9E)-8-[tert-butyl(dimethyl)silyl]oxy-7-ethyl-3,5,9-trimethylundeca-1,5,9-trien-4-ol |
| SMILES | C=C[C@H](C)[C@H](O)/C(C)=C/[C@H](CC)[C@@H](O[Si](C)(C)C(C)(C)C)/C(C)=C/C |
| InChI | InChI=1S/C22H42O2Si/c1-12-16(4)20(23)18(6)15-19(14-3)21(17(5)13-2)24-25(10,11)22(7,8)9/h12-13,15-16,19-21,23H,1,14H2,2-11H3/b17-13+,18-15+/t16-,19-,20-,21-/m0/s1 |
| InChIKey | XRTLDYJQRWJWES-GMUGFIKNSA-N |
| XLogP | 6.50 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.66 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|