C11H15N3O5 — CID 25209678
2-nitro-6-(oxan-2-yloxy)-6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazine (PubChem CID 25209678) has the molecular formula C11H15N3O5 and a molecular weight of 269.26 g/mol. Its IUPAC name is 2-nitro-6-(oxan-2-yloxy)-6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazine.
| Compound Name | 2-nitro-6-(oxan-2-yloxy)-6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazine |
|---|---|
| PubChem CID | 25209678 |
| Molecular Formula | C11H15N3O5 |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | 2-nitro-6-(oxan-2-yloxy)-6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazine |
| SMILES | O=[N+]([O-])c1cc2n(n1)CC(OC1CCCCO1)CO2 |
| InChI | InChI=1S/C11H15N3O5/c15-14(16)9-5-10-13(12-9)6-8(7-18-10)19-11-3-1-2-4-17-11/h5,8,11H,1-4,6-7H2 |
| InChIKey | IBZATZAESUVEJC-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 88.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|