C18H33NO9 — CID 25209769
tert-butyl N-[(1S,4R,5S,6S)-3-(hydroxymethyl)-4,5,6-tris(methoxymethoxy)cyclohex-2-en-1-yl]carbamate (PubChem CID 25209769) has the molecular formula C18H33NO9 and a molecular weight of 407.46 g/mol. Its IUPAC name is tert-butyl N-[(1S,4R,5S,6S)-3-(hydroxymethyl)-4,5,6-tris(methoxymethoxy)cyclohex-2-en-1-yl]carbamate.
| Compound Name | tert-butyl N-[(1S,4R,5S,6S)-3-(hydroxymethyl)-4,5,6-tris(methoxymethoxy)cyclohex-2-en-1-yl]carbamate |
|---|---|
| PubChem CID | 25209769 |
| Molecular Formula | C18H33NO9 |
| Molecular Weight | 407.46 g/mol |
| Exact Mass | 407.22 |
| IUPAC Name | tert-butyl N-[(1S,4R,5S,6S)-3-(hydroxymethyl)-4,5,6-tris(methoxymethoxy)cyclohex-2-en-1-yl]carbamate |
| SMILES | COCO[C@@H]1[C@@H](OCOC)[C@H](OCOC)C(CO)=C[C@@H]1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H33NO9/c1-18(2,3)28-17(21)19-13-7-12(8-20)14(25-9-22-4)16(27-11-24-6)15(13)26-10-23-5/h7,13-16,20H,8-11H2,1-6H3,(H,19,21)/t13-,14+,15-,16-/m0/s1 |
| InChIKey | BDZIXCVFSMOFBR-FZKCQIBNSA-N |
| XLogP | 0.78 |
| TPSA | 113.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.46 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|