C30H49N3O7 — CID 25209840
ethyl (2S)-2-[[(1R,2S,5S)-6,6-dimethyl-3-[(2S,3S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-prop-2-enoxybutanoyl]-3-azabicyclo[3.1.0]hexane-2-carbonyl]amino]oct-7-enoate (PubChem CID 25209840) has the molecular formula C30H49N3O7 and a molecular weight of 563.74 g/mol. Its IUPAC name is ethyl (2S)-2-[[(1R,2S,5S)-6,6-dimethyl-3-[(2S,3S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-prop-2-enoxybutanoyl]-3-azabicyclo[3.1.0]hexane-2-carbonyl]amino]oct-7-enoate.
| Compound Name | ethyl (2S)-2-[[(1R,2S,5S)-6,6-dimethyl-3-[(2S,3S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-prop-2-enoxybutanoyl]-3-azabicyclo[3.1.0]hexane-2-carbonyl]amino]oct-7-enoate |
|---|---|
| PubChem CID | 25209840 |
| Molecular Formula | C30H49N3O7 |
| Molecular Weight | 563.74 g/mol |
| Exact Mass | 563.36 |
| IUPAC Name | ethyl (2S)-2-[[(1R,2S,5S)-6,6-dimethyl-3-[(2S,3S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-prop-2-enoxybutanoyl]-3-azabicyclo[3.1.0]hexane-2-carbonyl]amino]oct-7-enoate |
| SMILES | C=CCCCC[C@H](NC(=O)[C@@H]1[C@@H]2[C@H](CN1C(=O)[C@@H](NC(=O)OC(C)(C)C)[C@H](C)OCC=C)C2(C)C)C(=O)OCC |
| InChI | InChI=1S/C30H49N3O7/c1-10-13-14-15-16-21(27(36)38-12-3)31-25(34)24-22-20(30(22,8)9)18-33(24)26(35)23(19(4)39-17-11-2)32-28(37)40-29(5,6)7/h10-11,19-24H,1-2,12-18H2,3-9H3,(H,31,34)(H,32,37)/t19-,20-,21-,22-,23-,24-/m0/s1 |
| InChIKey | MPXQLVCIVOXNCP-BTNSXGMBSA-N |
| XLogP | 3.75 |
| TPSA | 123.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.74 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|