About N-[2-[2-[(6-amino-2,3-dihydroindol-1-yl)methyl]-5-methoxy-1H-indol-3-yl]ethyl]acetamide
N-[2-[2-[(6-amino-2,3-dihydroindol-1-yl)methyl]-5-methoxy-1H-indol-3-yl]ethyl]acetamide (PubChem CID 25210135) has the molecular formula C22H26N4O2
and a molecular weight of 378.48 g/mol. Its IUPAC name is N-[2-[2-[(6-amino-2,3-dihydroindol-1-yl)methyl]-5-methoxy-1H-indol-3-yl]ethyl]acetamide.
Molecular Properties
| Compound Name | N-[2-[2-[(6-amino-2,3-dihydroindol-1-yl)methyl]-5-methoxy-1H-indol-3-yl]ethyl]acetamide |
| PubChem CID | 25210135 |
| Molecular Formula | C22H26N4O2 |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.21 |
| IUPAC Name | N-[2-[2-[(6-amino-2,3-dihydroindol-1-yl)methyl]-5-methoxy-1H-indol-3-yl]ethyl]acetamide |
| SMILES | COc1ccc2[nH]c(CN3CCc4ccc(N)cc43)c(CCNC(C)=O)c2c1 |
| InChI | InChI=1S/C22H26N4O2/c1-14(27)24-9-7-18-19-12-17(28-2)5-6-20(19)25-21(18)13-26-10-8-15-3-4-16(23)11-22(15)26/h3-6,11-12,25H,7-10,13,23H2,1-2H3,(H,24,27) |
| InChIKey | GCEPARAASJJCET-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 83.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze N-[2-[2-[(6-amino-2,3-dihydroindol-1-yl)methyl]-5-methoxy-1H-indol-3-yl]ethyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[2-[(6-amino-2,3-dihydroindol-1-yl)methyl]-5-methoxy-1H-indol-3-yl]ethyl]acetamide?
The IUPAC name of N-[2-[2-[(6-amino-2,3-dihydroindol-1-yl)methyl]-5-methoxy-1H-indol-3-yl]ethyl]acetamide (CID 25210135) is N-[2-[2-[(6-amino-2,3-dihydroindol-1-yl)methyl]-5-methoxy-1H-indol-3-yl]ethyl]acetamide.
What is the SMILES notation for N-[2-[2-[(6-amino-2,3-dihydroindol-1-yl)methyl]-5-methoxy-1H-indol-3-yl]ethyl]acetamide?
The canonical SMILES for N-[2-[2-[(6-amino-2,3-dihydroindol-1-yl)methyl]-5-methoxy-1H-indol-3-yl]ethyl]acetamide is COc1ccc2[nH]c(CN3CCc4ccc(N)cc43)c(CCNC(C)=O)c2c1.
What is the InChIKey of N-[2-[2-[(6-amino-2,3-dihydroindol-1-yl)methyl]-5-methoxy-1H-indol-3-yl]ethyl]acetamide?
The InChIKey is GCEPARAASJJCET-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H26N4O2/c1-14(27)24-9-7-18-19-12-17(28-2)5-6-20(19)25-21(18)13-26-10-8-15-3-4-16(23)11-22(15)26/h3-6,11-12,25H,7-10,13,23H2,1-2H3,(H,24,27).
What are the key properties of N-[2-[2-[(6-amino-2,3-dihydroindol-1-yl)methyl]-5-methoxy-1H-indol-3-yl]ethyl]acetamide?
N-[2-[2-[(6-amino-2,3-dihydroindol-1-yl)methyl]-5-methoxy-1H-indol-3-yl]ethyl]acetamide has a molecular weight of 378.48 g/mol, XLogP of 3.00, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[2-[(6-amino-2,3-dihydroindol-1-yl)methyl]-5-methoxy-1H-indol-3-yl]ethyl]acetamide is sourced from PubChem (CID 25210135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).