About N-[6-(diethylamino)-2-(3,5-dimethylpyrazol-1-yl)pyrimidin-4-yl]acetamide
N-[6-(diethylamino)-2-(3,5-dimethylpyrazol-1-yl)pyrimidin-4-yl]acetamide (PubChem CID 25210254) has the molecular formula C15H22N6O
and a molecular weight of 302.38 g/mol. Its IUPAC name is N-[6-(diethylamino)-2-(3,5-dimethylpyrazol-1-yl)pyrimidin-4-yl]acetamide.
Molecular Properties
| Compound Name | N-[6-(diethylamino)-2-(3,5-dimethylpyrazol-1-yl)pyrimidin-4-yl]acetamide |
| PubChem CID | 25210254 |
| Molecular Formula | C15H22N6O |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | N-[6-(diethylamino)-2-(3,5-dimethylpyrazol-1-yl)pyrimidin-4-yl]acetamide |
| SMILES | CCN(CC)c1cc(NC(C)=O)nc(-n2nc(C)cc2C)n1 |
| InChI | InChI=1S/C15H22N6O/c1-6-20(7-2)14-9-13(16-12(5)22)17-15(18-14)21-11(4)8-10(3)19-21/h8-9H,6-7H2,1-5H3,(H,16,17,18,22) |
| InChIKey | WGINQISWUSBVEU-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[6-(diethylamino)-2-(3,5-dimethylpyrazol-1-yl)pyrimidin-4-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[6-(diethylamino)-2-(3,5-dimethylpyrazol-1-yl)pyrimidin-4-yl]acetamide?
The IUPAC name of N-[6-(diethylamino)-2-(3,5-dimethylpyrazol-1-yl)pyrimidin-4-yl]acetamide (CID 25210254) is N-[6-(diethylamino)-2-(3,5-dimethylpyrazol-1-yl)pyrimidin-4-yl]acetamide.
What is the SMILES notation for N-[6-(diethylamino)-2-(3,5-dimethylpyrazol-1-yl)pyrimidin-4-yl]acetamide?
The canonical SMILES for N-[6-(diethylamino)-2-(3,5-dimethylpyrazol-1-yl)pyrimidin-4-yl]acetamide is CCN(CC)c1cc(NC(C)=O)nc(-n2nc(C)cc2C)n1.
What is the InChIKey of N-[6-(diethylamino)-2-(3,5-dimethylpyrazol-1-yl)pyrimidin-4-yl]acetamide?
The InChIKey is WGINQISWUSBVEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N6O/c1-6-20(7-2)14-9-13(16-12(5)22)17-15(18-14)21-11(4)8-10(3)19-21/h8-9H,6-7H2,1-5H3,(H,16,17,18,22).
What are the key properties of N-[6-(diethylamino)-2-(3,5-dimethylpyrazol-1-yl)pyrimidin-4-yl]acetamide?
N-[6-(diethylamino)-2-(3,5-dimethylpyrazol-1-yl)pyrimidin-4-yl]acetamide has a molecular weight of 302.38 g/mol, XLogP of 2.08, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[6-(diethylamino)-2-(3,5-dimethylpyrazol-1-yl)pyrimidin-4-yl]acetamide is sourced from PubChem (CID 25210254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).