About 3-fluoropiperidin-4-one
3-fluoropiperidin-4-one (PubChem CID 25210511) has the molecular formula C5H8FNO
and a molecular weight of 117.12 g/mol. Its IUPAC name is 3-fluoropiperidin-4-one.
Molecular Properties
| Compound Name | 3-fluoropiperidin-4-one |
| PubChem CID | 25210511 |
| Molecular Formula | C5H8FNO |
| Molecular Weight | 117.12 g/mol |
| Exact Mass | 117.06 |
| IUPAC Name | 3-fluoropiperidin-4-one |
| SMILES | O=C1CCNCC1F |
| InChI | InChI=1S/C5H8FNO/c6-4-3-7-2-1-5(4)8/h4,7H,1-3H2 |
| InChIKey | GYCGAPQMEYPDIJ-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 117.12 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-fluoropiperidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoropiperidin-4-one?
The IUPAC name of 3-fluoropiperidin-4-one (CID 25210511) is 3-fluoropiperidin-4-one.
What is the SMILES notation for 3-fluoropiperidin-4-one?
The canonical SMILES for 3-fluoropiperidin-4-one is O=C1CCNCC1F.
What is the InChIKey of 3-fluoropiperidin-4-one?
The InChIKey is GYCGAPQMEYPDIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8FNO/c6-4-3-7-2-1-5(4)8/h4,7H,1-3H2.
What are the key properties of 3-fluoropiperidin-4-one?
3-fluoropiperidin-4-one has a molecular weight of 117.12 g/mol, XLogP of -0.11, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoropiperidin-4-one is sourced from PubChem (CID 25210511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).