About 3-[[4-[(2,4-dioxo-1H-pyrimidin-6-yl)methylamino]butylamino]methyl]benzoic acid
3-[[4-[(2,4-dioxo-1H-pyrimidin-6-yl)methylamino]butylamino]methyl]benzoic acid (PubChem CID 25210542) has the molecular formula C17H22N4O4
and a molecular weight of 346.39 g/mol. Its IUPAC name is 3-[[4-[(2,4-dioxo-1H-pyrimidin-6-yl)methylamino]butylamino]methyl]benzoic acid.
Molecular Properties
| Compound Name | 3-[[4-[(2,4-dioxo-1H-pyrimidin-6-yl)methylamino]butylamino]methyl]benzoic acid |
| PubChem CID | 25210542 |
| Molecular Formula | C17H22N4O4 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | 3-[[4-[(2,4-dioxo-1H-pyrimidin-6-yl)methylamino]butylamino]methyl]benzoic acid |
| SMILES | O=C(O)c1cccc(CNCCCCNCc2cc(=O)[nH]c(=O)[nH]2)c1 |
| InChI | InChI=1S/C17H22N4O4/c22-15-9-14(20-17(25)21-15)11-19-7-2-1-6-18-10-12-4-3-5-13(8-12)16(23)24/h3-5,8-9,18-19H,1-2,6-7,10-11H2,(H,23,24)(H2,20,21,22,25) |
| InChIKey | PLKKHOGCWCJFJX-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 127.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[[4-[(2,4-dioxo-1H-pyrimidin-6-yl)methylamino]butylamino]methyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[4-[(2,4-dioxo-1H-pyrimidin-6-yl)methylamino]butylamino]methyl]benzoic acid?
The IUPAC name of 3-[[4-[(2,4-dioxo-1H-pyrimidin-6-yl)methylamino]butylamino]methyl]benzoic acid (CID 25210542) is 3-[[4-[(2,4-dioxo-1H-pyrimidin-6-yl)methylamino]butylamino]methyl]benzoic acid.
What is the SMILES notation for 3-[[4-[(2,4-dioxo-1H-pyrimidin-6-yl)methylamino]butylamino]methyl]benzoic acid?
The canonical SMILES for 3-[[4-[(2,4-dioxo-1H-pyrimidin-6-yl)methylamino]butylamino]methyl]benzoic acid is O=C(O)c1cccc(CNCCCCNCc2cc(=O)[nH]c(=O)[nH]2)c1.
What is the InChIKey of 3-[[4-[(2,4-dioxo-1H-pyrimidin-6-yl)methylamino]butylamino]methyl]benzoic acid?
The InChIKey is PLKKHOGCWCJFJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N4O4/c22-15-9-14(20-17(25)21-15)11-19-7-2-1-6-18-10-12-4-3-5-13(8-12)16(23)24/h3-5,8-9,18-19H,1-2,6-7,10-11H2,(H,23,24)(H2,20,21,22,25).
What are the key properties of 3-[[4-[(2,4-dioxo-1H-pyrimidin-6-yl)methylamino]butylamino]methyl]benzoic acid?
3-[[4-[(2,4-dioxo-1H-pyrimidin-6-yl)methylamino]butylamino]methyl]benzoic acid has a molecular weight of 346.39 g/mol, XLogP of 0.42, 10 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[4-[(2,4-dioxo-1H-pyrimidin-6-yl)methylamino]butylamino]methyl]benzoic acid is sourced from PubChem (CID 25210542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).